1. <source id="evxgb"><li id="evxgb"><delect id="evxgb"></delect></li></source>
      1. <source id="evxgb"><span id="evxgb"></span></source>
        1. <code id="evxgb"><span id="evxgb"></span></code>
              1. <source id="evxgb"></source>

                ——  2-hydroxymethyl-9-methyl-6-(1-methylethyl)-1,4-dioxaspiro[4.5]decane  ——

                Product name: 2-hydroxymethyl-9-methyl-6-(1-methylethyl)-1,4-dioxaspiro[4.5]decane
                English name: 2-hydroxymethyl-9-methyl-6-(1-methylethyl)-1,4-dioxaspiro[4.5]decane
                Alias: Menthone 1,2-glycerol ketal; 1,4-Dioxaspiro(4.5)decane-2-methanol, 9-methyl-6-(1-methylethyl)-; 6-Isopropyl-9-methyl-1,4-dioxaspiro(4.5)decane-2-methanol; 9-Methyl-6-(1-methylethyl)-1,4-dioxaspiro(4.5)decane-2-methanol; [9-methyl-6-(propan-2-yl)-1,4-dioxaspiro[4.5]dec-2-yl]methanol; L-Menthone glycerin acetal
                CAS RN: 63187-91-7
                EINECS No.: 408-200-3
                Molecular formula: C13H24O3
                Molecular weight: 228.3279
                InChI: InChI=1/C13H24O3/c1-9(2)12-5-4-10(3)6-13(12)15-8-11(7-14)16-13/h9-12,14H,4-8H2,1-3H3
                Molecular structure:
                Density: 1.04g/cm³
                Boiling point: 322.9°C at 760 mmHg
                Flash point: 159.7°C
                Vapor pressure: 2.15E-05mmHg at 25°C

                [ Back Products ]

                  Previous product: Trans-3-hexenoic acid
                  Next product: 2-Ethoxypyrazine

                1. <source id="evxgb"><li id="evxgb"><delect id="evxgb"></delect></li></source>
                  1. <source id="evxgb"><span id="evxgb"></span></source>
                    1. <code id="evxgb"><span id="evxgb"></span></code>
                          1. <source id="evxgb"></source>